CAS 85221-17-6 appears in our catalog under these names: 4-Acetylphenyl (3,4-dichlorophenyl)carbamate, 95%, 4-Acetylphenyl (3,4-dichlorophenyl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(4-acetylphenyl) N-(3,4-dichlorophenyl)carbamate (CAS 85221-17-6) is a chemical compound with the molecular formula C15H11Cl2NO3 and a molecular weight of 324.2 g/mol. IUPAC name: (4-acetylphenyl) N-(3,4-dichlorophenyl)carbamate. InChIKey: SVADXMBEHYZPGI-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | (4-acetylphenyl) N-(3,4-dichlorophenyl)carbamate |
| InChIKey | SVADXMBEHYZPGI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)