Products 518021-63-1

CAS 518021-63-1 is the registry number for 2-(2,4-Dichlorobenzamido)-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid (CAS 518021-63-1) is a chemical compound with the molecular formula C15H11Cl2NO3 and a molecular weight of 324.2 g/mol. IUPAC name: 2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid. InChIKey: BXQIAYMIOWYCGX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11Cl2NO3
Molecular weight324.2 g/mol
IUPAC name2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid
InChIKeyBXQIAYMIOWYCGX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)