CAS 42595-25-5 is the registry number for 3-Chloro-9-acridinecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
3-chloroacridine-9-carboxylic acid (CAS 42595-25-5) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 3-chloroacridine-9-carboxylic acid. InChIKey: MGPYAGVLXOWEJV-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 3-chloroacridine-9-carboxylic acid |
| InChIKey | MGPYAGVLXOWEJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC(=CC3=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)