CAS 42599-89-3 is the registry number for 2-((1S)-1-Hydroxyethyl)-1,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
2-[(1S)-1-hydroxyethyl]-3H-quinazolin-4-one (CAS 42599-89-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-[(1S)-1-hydroxyethyl]-3H-quinazolin-4-one. InChIKey: BMBSGGZMJQTQSO-LURJTMIESA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-[(1S)-1-hydroxyethyl]-3H-quinazolin-4-one |
| InChIKey | BMBSGGZMJQTQSO-LURJTMIESA-N |
| SMILES | C[C@@H](C1=NC2=CC=CC=C2C(=O)N1)O |
Computed by PubChem (NCBI)