Products 426828-36-6
CAS 426828-36-6 appears in our catalog under these names: 2-Cyanobenzamidine hydrochloride, 95%, 2-Cyanobenzamidine Hydrochloride, 95+%, 2-Cyanobenzamidine Hydrochloride, ≥95%, ≥95%, 2-Cyanobenzimidamide hydrochloride, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
2-cyanobenzenecarboximidamide;hydrochloride (CAS 426828-36-6) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 2-cyanobenzenecarboximidamide;hydrochloride. InChIKey: AWGKIZLAUKEEDM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-cyanobenzenecarboximidamide;hydrochloride |
| InChIKey | AWGKIZLAUKEEDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C(=N)N.Cl |
Computed by PubChem (NCBI)