CAS 42746-49-6 appears in our catalog under these names: 5-benzyl-1,3-oxazolidin-2-one, 5-Benzyloxazolidin-2-one, 97%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g.
5-benzyl-1,3-oxazolidin-2-one (CAS 42746-49-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 5-benzyl-1,3-oxazolidin-2-one. InChIKey: DLBSGOZFSFUDKO-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-benzyl-1,3-oxazolidin-2-one |
| InChIKey | DLBSGOZFSFUDKO-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)