Products 42872-32-2

CAS 42872-32-2 is the registry number for Ketoprofen Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(cyanomethyl)benzoyl chloride (CAS 42872-32-2) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-(cyanomethyl)benzoyl chloride. InChIKey: OAYBUIAMMUILDS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClNO
Molecular weight179.60 g/mol
IUPAC name3-(cyanomethyl)benzoyl chloride
InChIKeyOAYBUIAMMUILDS-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)Cl)CC#N

Computed by PubChem (NCBI)