CAS 42872-32-2 is the registry number for Ketoprofen Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
3-(cyanomethyl)benzoyl chloride (CAS 42872-32-2) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-(cyanomethyl)benzoyl chloride. InChIKey: OAYBUIAMMUILDS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-(cyanomethyl)benzoyl chloride |
| InChIKey | OAYBUIAMMUILDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)CC#N |
Computed by PubChem (NCBI)