Products 42923-42-2
CAS 42923-42-2 is the registry number for 5,7-Dihydroxy-3,8,3',4'-tetramethoxyflavone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3,8-dimethoxychromen-4-one (CAS 42923-42-2) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3,8-dimethoxychromen-4-one. InChIKey: MBOJUFZHGKKHLS-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-3,8-dimethoxychromen-4-one |
| InChIKey | MBOJUFZHGKKHLS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC)OC)OC |
Computed by PubChem (NCBI)