CAS 42952-91-0 appears in our catalog under these names: N-Nitrosodiphenylamine-d10, >95% (HPLC), N-Nitroso-diphenylamine D10. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg.
N,N-bis(2,3,4,5,6-pentadeuteriophenyl)nitrous amide (CAS 42952-91-0) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 208.28 g/mol. IUPAC name: N,N-bis(2,3,4,5,6-pentadeuteriophenyl)nitrous amide. InChIKey: UBUCNCOMADRQHX-LHNTUAQVSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | N,N-bis(2,3,4,5,6-pentadeuteriophenyl)nitrous amide |
| InChIKey | UBUCNCOMADRQHX-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])N=O)[2H])[2H] |
Computed by PubChem (NCBI)