CAS 93951-95-2 appears in our catalog under these names: Benzen-2,4,6-d3-amine, N-nitroso-N-(phenyl-2,4,6-d3), N-Nitrosodiphenyl-2,2',4,4',6,6'-d6-amine, >95% (HPLC), N-Nitrosodiphenyl-2,2',4,4',6,6'-d6-amine, 98 atom % D, min 98% Chemical Purity, N-Nitroso-diphenylamine D6 (2,2',4,4',6,6'-D6), N-Nitrosodiphenyl-2,2',4,4',6,6'-d6-amine. Offered by: Chemat Brand, TRC, CDN, Dr. Ehrenstorfer, Biosynth. Available pack sizes: on request, 10mg, 1mg, 2mg, 0,05g, 0,01g, 25mg, 50mg.
N,N-bis(2,4,6-trideuteriophenyl)nitrous amide (CAS 93951-95-2) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 204.26 g/mol. IUPAC name: N,N-bis(2,4,6-trideuteriophenyl)nitrous amide. InChIKey: UBUCNCOMADRQHX-MWJWXFQUSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | N,N-bis(2,4,6-trideuteriophenyl)nitrous amide |
| InChIKey | UBUCNCOMADRQHX-MWJWXFQUSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)[2H])N(C2=C(C=C(C=C2[2H])[2H])[2H])N=O)[2H] |
Computed by PubChem (NCBI)