CAS 429653-28-1 appears in our catalog under these names: VU0038882, VU0038882, 95+%. Offered by: MedChemExpress, Ambeed. Available pack sizes: Get quote, 50mg.
2-[5-(furan-2-yl)-1H-pyrazol-3-yl]naphthalen-1-ol (CAS 429653-28-1) is a chemical compound with the molecular formula C17H12N2O2 and a molecular weight of 276.29 g/mol. IUPAC name: 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]naphthalen-1-ol. InChIKey: AUFKOSNMJAYSCA-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O2 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 2-[5-(furan-2-yl)-1H-pyrazol-3-yl]naphthalen-1-ol |
| InChIKey | AUFKOSNMJAYSCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)C3=NNC(=C3)C4=CC=CO4 |
Computed by PubChem (NCBI)