Products 431047-39-1
CAS 431047-39-1 is the registry number for Propan-2-yl 4-(4-methylphenoxy)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Propan-2-yl 4-(4-methylphenoxy)benzoate (CAS 431047-39-1) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: propan-2-yl 4-(4-methylphenoxy)benzoate. InChIKey: GPEWXIRVKSTQOR-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | propan-2-yl 4-(4-methylphenoxy)benzoate |
| InChIKey | GPEWXIRVKSTQOR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)OC(C)C |
Computed by PubChem (NCBI)