Products 4324-55-4
CAS 4324-55-4 appears in our catalog under these names: 6-Hydroxykaempferol, 6-Hydroxykaempferol, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 2mg, 10mg, 5 mg, 1 mg.
3,5,6,7-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 4324-55-4) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 302.23 g/mol. IUPAC name: 3,5,6,7-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: LFPHMXIOQBBTSS-UHFFFAOYSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 302.23 g/mol |
| IUPAC name | 3,5,6,7-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | LFPHMXIOQBBTSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C=C(C(=C3O)O)O)O)O |
Computed by PubChem (NCBI)