CAS 4326-36-7 appears in our catalog under these names: Boc–Tyr–OMe, Boc-L-Tyr-OMe, N-Boc-L-tyrosine methyl ester, 99% , Boc-L-tyrosine methyl ester, BOC-L-Tyrosine methyl ester, 97%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 5g, 0,5kg, 1kg, 2kg, 5kg, 250g.
Methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 4326-36-7) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: NQIFXJSLCUJHBB-LBPRGKRZSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | NQIFXJSLCUJHBB-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)OC |
Computed by PubChem (NCBI)