CAS 4345-49-7 is the registry number for 3,5-Dimethyl-4-phenyl-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethyl-4-phenyl-1H-pyrazole (CAS 4345-49-7) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 3,5-dimethyl-4-phenyl-1H-pyrazole. InChIKey: ZKTZVPARPDWOAO-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 3,5-dimethyl-4-phenyl-1H-pyrazole |
| InChIKey | ZKTZVPARPDWOAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)