CAS 4349-62-6 appears in our catalog under these names: 2-(Benzyloxy)benzoyl chloride, 95%, 2-(Benzyloxy)benzoyl chloride, 2-BENZYLOXYBENZOYL CHLORIDE, 97%. Offered by: Combi-blocks, TRC, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg.
2-phenylmethoxybenzoyl chloride (CAS 4349-62-6) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-phenylmethoxybenzoyl chloride. InChIKey: ITDFRSCTQXOUAC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-phenylmethoxybenzoyl chloride |
| InChIKey | ITDFRSCTQXOUAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2C(=O)Cl |
Computed by PubChem (NCBI)