CAS 436152-83-9 is the registry number for 4-(2,5-Dimethyl-thiophen-3-yl)-thiazol-2-ylamine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine (CAS 436152-83-9) is a chemical compound with the molecular formula C9H10N2S2 and a molecular weight of 210.3 g/mol. IUPAC name: 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine. InChIKey: SKDWLGWJNNTNGX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine |
| InChIKey | SKDWLGWJNNTNGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)