CAS 743452-19-9 appears in our catalog under these names: 2,5,6-Trimethylthieno[2,3-d]pyrimidine-4-thiol, 95%, 2,5,6-Trimethylthieno(2,3-d)pyrimidine-4-thiol, 97%, 2,5,6-Trimethyl-thieno(2,3-d)pyrimidine-4-thiol, 2,5,6-Trimethyl-thieno[2,3-d]pyrimidine-4-thiol. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidine-4-thione (CAS 743452-19-9) is a chemical compound with the molecular formula C9H10N2S2 and a molecular weight of 210.3 g/mol. IUPAC name: 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidine-4-thione. InChIKey: FPLWPHYNYQLYEK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | 2,5,6-trimethyl-3H-thieno[2,3-d]pyrimidine-4-thione |
| InChIKey | FPLWPHYNYQLYEK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=S)NC(=N2)C)C |
Computed by PubChem (NCBI)