CAS 524932-70-5 appears in our catalog under these names: 4-(5-Ethylthien-2-yl)-1,3-thiazol-2-amine, 95%, 4-(5-Ethylthiophen-2-yl)thiazol-2-amine, 95+%, 4-(5-Ethylthiophen-2-yl)thiazol-2-ylamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
4-(5-ethylthiophen-2-yl)-1,3-thiazol-2-amine (CAS 524932-70-5) is a chemical compound with the molecular formula C9H10N2S2 and a molecular weight of 210.3 g/mol. IUPAC name: 4-(5-ethylthiophen-2-yl)-1,3-thiazol-2-amine. InChIKey: GYZHXUUINWLKJY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | 4-(5-ethylthiophen-2-yl)-1,3-thiazol-2-amine |
| InChIKey | GYZHXUUINWLKJY-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(S1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)