CAS 868238-07-7 is the registry number for [5-(2-Methyl-1,3-thiazol-4-yl)thien-2-yl]methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methanamine (CAS 868238-07-7) is a chemical compound with the molecular formula C9H10N2S2 and a molecular weight of 210.3 g/mol. IUPAC name: [5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methanamine. InChIKey: KKXXKTKEZQJYKE-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | [5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methanamine |
| InChIKey | KKXXKTKEZQJYKE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(S2)CN |
Computed by PubChem (NCBI)