CAS 860180-92-3 is the registry number for Bis(4-methylthiazol-2-yl)methylene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole (CAS 860180-92-3) is a chemical compound with the molecular formula C9H10N2S2 and a molecular weight of 210.3 g/mol. IUPAC name: 4-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole. InChIKey: DZPDEFMTQJQHEX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | 4-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole |
| InChIKey | DZPDEFMTQJQHEX-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CC2=NC(=CS2)C |
Computed by PubChem (NCBI)