CAS 4371-35-1 appears in our catalog under these names: 2,2',6,6'-Tetrahydroxy-1,1'-Biphenyl, [1,1'-Biphenyl]-2,2',6,6'-tetraol, 95%, 95%, [1,1'-Biphenyl]-2,2',6,6'-tetraol, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2-(2,6-dihydroxyphenyl)benzene-1,3-diol (CAS 4371-35-1) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 2-(2,6-dihydroxyphenyl)benzene-1,3-diol. InChIKey: HXBBWWNXODCSPT-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-(2,6-dihydroxyphenyl)benzene-1,3-diol |
| InChIKey | HXBBWWNXODCSPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C2=C(C=CC=C2O)O)O |
Computed by PubChem (NCBI)