CAS 4372-31-0 is the registry number for Diallylmalonic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
2,2-bis(prop-2-enyl)propanedioic acid (CAS 4372-31-0) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2,2-bis(prop-2-enyl)propanedioic acid. InChIKey: VSJZBUJCPNVRET-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2,2-bis(prop-2-enyl)propanedioic acid |
| InChIKey | VSJZBUJCPNVRET-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)