CAS 4382-50-7 appears in our catalog under these names: DMT Oxalate, N,N-Dimethyltryptamine oxalate. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
2-(5-hydroxy-1H-indol-3-yl)ethyl-dimethylazanium;2-hydroxy-2-oxoacetate (CAS 4382-50-7) is a chemical compound with the molecular formula C14H18N2O5 and a molecular weight of 294.30 g/mol. IUPAC name: 2-(5-hydroxy-1H-indol-3-yl)ethyl-dimethylazanium;2-hydroxy-2-oxoacetate. InChIKey: DYESHNNFAFXIKV-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O5 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-(5-hydroxy-1H-indol-3-yl)ethyl-dimethylazanium;2-hydroxy-2-oxoacetate |
| InChIKey | DYESHNNFAFXIKV-UHFFFAOYSA-N |
| SMILES | C[NH+](C)CCC1=CNC2=C1C=C(C=C2)O.C(=O)(C(=O)[O-])O |
Computed by PubChem (NCBI)