Products 438220-78-1
CAS 438220-78-1 is the registry number for 4-Methoxy-3-((3-methylphenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-methoxy-3-[(3-methylphenoxy)methyl]benzoic acid (CAS 438220-78-1) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 4-methoxy-3-[(3-methylphenoxy)methyl]benzoic acid. InChIKey: KMWJNHRFMMKBQQ-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 4-methoxy-3-[(3-methylphenoxy)methyl]benzoic acid |
| InChIKey | KMWJNHRFMMKBQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OCC2=C(C=CC(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)