CAS 438465-41-9 is the registry number for 3-{(4-(Propan-2-yl)phenoxy)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[(4-propan-2-ylphenoxy)methyl]benzoic acid (CAS 438465-41-9) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 3-[(4-propan-2-ylphenoxy)methyl]benzoic acid. InChIKey: CJNBIZCLHOSLTO-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 3-[(4-propan-2-ylphenoxy)methyl]benzoic acid |
| InChIKey | CJNBIZCLHOSLTO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)OCC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)