CAS 4385-76-6 appears in our catalog under these names: 4-Pyrid-4-ylbenzoic acid, 95% , 4-(4-Pyridyl)benzoic acid, 98%, 98%, 4-Pyridin-4-yl-benzoic acid, 95%, 4-Pyridin-4-yl-benzoic acid, 98%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 10g, 5g, 25g, 100g.
4-pyridin-4-ylbenzoic acid (CAS 4385-76-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 4-pyridin-4-ylbenzoic acid. InChIKey: DZLGZIGLHCRIMF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 4-pyridin-4-ylbenzoic acid |
| InChIKey | DZLGZIGLHCRIMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)C(=O)O |
Computed by PubChem (NCBI)