CAS 4385-77-7 appears in our catalog under these names: 3–Pyridin–3–yl–benzoic acid, 3-Pyrid-3-ylbenzoic acid, 95% , 3-Pyridin-3-yl-benzoic acid, 97%, 97%, 3-(3'-Pyridyl)benzoic acid, 97%. Offered by: GLPBio, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250MG.
3-pyridin-3-ylbenzoic acid (CAS 4385-77-7) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 3-pyridin-3-ylbenzoic acid. InChIKey: PXASTGBSGPFLFJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 3-pyridin-3-ylbenzoic acid |
| InChIKey | PXASTGBSGPFLFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)