Products 438532-72-0

CAS 438532-72-0 is the registry number for 2-Methyl 4-propyl 5-amino-3-methylthiophene-2,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

2-O-methyl 4-O-propyl 5-amino-3-methylthiophene-2,4-dicarboxylate (CAS 438532-72-0) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 2-O-methyl 4-O-propyl 5-amino-3-methylthiophene-2,4-dicarboxylate. InChIKey: IFISJQMZJNEHMG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4S
Molecular weight257.31 g/mol
IUPAC name2-O-methyl 4-O-propyl 5-amino-3-methylthiophene-2,4-dicarboxylate
InChIKeyIFISJQMZJNEHMG-UHFFFAOYSA-N
SMILESCCCOC(=O)C1=C(SC(=C1C)C(=O)OC)N

Computed by PubChem (NCBI)