Products 4386-40-7
CAS 4386-40-7 appears in our catalog under these names: 5-Chloro-2-hydroxy-3-methylbenzoic acid, 95%, 5-Chloro-2-hydroxy-3-methylbenzoic acid 95%, 5-Chloro-2-hydroxy-3-methylbenzoic acid, 95%, 95%, 5-Chloro-2-hydroxy-3-methylbenzoic acid, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 5g, 1g, 250mg.
5-chloro-2-hydroxy-3-methylbenzoic acid (CAS 4386-40-7) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 5-chloro-2-hydroxy-3-methylbenzoic acid. InChIKey: LVTWXQZCFTXATF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-3-methylbenzoic acid |
| InChIKey | LVTWXQZCFTXATF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C(=O)O)Cl |
Computed by PubChem (NCBI)