CAS 438614-65-4 is the registry number for N,N-Diallyl-2-chloronicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N,N-bis(prop-2-enyl)pyridine-3-carboxamide (CAS 438614-65-4) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 2-chloro-N,N-bis(prop-2-enyl)pyridine-3-carboxamide. InChIKey: FBCUQVMYSWJVEV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 2-chloro-N,N-bis(prop-2-enyl)pyridine-3-carboxamide |
| InChIKey | FBCUQVMYSWJVEV-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)C(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)