CAS 439085-78-6 is the registry number for 4-Chlorocinnolin-6-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorocinnolin-6-ol (CAS 439085-78-6) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 4-chlorocinnolin-6-ol. InChIKey: IDPWUYHQPWZKIU-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 4-chlorocinnolin-6-ol |
| InChIKey | IDPWUYHQPWZKIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=CN=N2)Cl |
Computed by PubChem (NCBI)