Products 439097-57-1
CAS 439097-57-1 is the registry number for 1-(3-(Trifluoromethyl)benzoyl)piperidin-4-one. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
1-[3-(trifluoromethyl)benzoyl]piperidin-4-one (CAS 439097-57-1) is a chemical compound with the molecular formula C13H12F3NO2 and a molecular weight of 271.23 g/mol. IUPAC name: 1-[3-(trifluoromethyl)benzoyl]piperidin-4-one. InChIKey: MKADAVGEWXLVKP-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO2 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)benzoyl]piperidin-4-one |
| InChIKey | MKADAVGEWXLVKP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(=O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)