Products 439612-08-5

CAS 439612-08-5 is the registry number for Vibegron Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 439612-08-5) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: UYJIMKBHJZIEQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO5
Molecular weight295.33 g/mol
IUPAC namemethyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate
InChIKeyUYJIMKBHJZIEQZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(C(C1=CC=CC=C1)O)C(=O)OC

Computed by PubChem (NCBI)