CAS 136620-82-1 is the registry number for Vibegron Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 136620-82-1) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: UYJIMKBHJZIEQZ-RYUDHWBXSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | UYJIMKBHJZIEQZ-RYUDHWBXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@H](C1=CC=CC=C1)O)C(=O)OC |
Computed by PubChem (NCBI)