CAS 439935-54-3 appears in our catalog under these names: 4-Methyl-3-(2,4,6-trimethylbenzenesulfonamido)benzoic acid, 95%, 4-Methyl-3-(2,4,6-trimethyl-benzenesulfonylamino)-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
4-methyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid (CAS 439935-54-3) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 4-methyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid. InChIKey: LTUWGDCXUSDXKK-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 4-methyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | LTUWGDCXUSDXKK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NS(=O)(=O)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)