Products 441074-78-8
CAS 441074-78-8 is the registry number for 1-(3,4-Difluorophenyl)propan-1-amine hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(3,4-difluorophenyl)propan-1-amine;hydrochloride (CAS 441074-78-8) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 1-(3,4-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: BNFNPNSBDYSQAL-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | BNFNPNSBDYSQAL-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)