CAS 4425-93-8 appears in our catalog under these names: 9H–Fluorene–9,9–dimethanol, 9H-Fluorene-9,9-dimethanol 98%, 9H-FLUORENE-9,9-DIMETHANOL, 98%, 9H-Fluorene-9,9-dimethanol, 98%, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
[9-(hydroxymethyl)fluoren-9-yl]methanol (CAS 4425-93-8) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: [9-(hydroxymethyl)fluoren-9-yl]methanol. InChIKey: RHBLISBUFROBBC-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | [9-(hydroxymethyl)fluoren-9-yl]methanol |
| InChIKey | RHBLISBUFROBBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(CO)CO |
Computed by PubChem (NCBI)