CAS 4433-77-6 appears in our catalog under these names: 3–oxo–2–Phenylbutanamide, 3-Oxo-2-phenyl butanamide. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
3-oxo-2-phenylbutanamide (CAS 4433-77-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 3-oxo-2-phenylbutanamide. InChIKey: FBISRXJSJBLOHX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 3-oxo-2-phenylbutanamide |
| InChIKey | FBISRXJSJBLOHX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=CC=CC=C1)C(=O)N |
Computed by PubChem (NCBI)