CAS 444004-76-6 appears in our catalog under these names: 1,3,5,7–Tetrahydroxy–8–prenylxanthone, 1,3,5,7-Tetrahydroxy-8-isoprenylxanthone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one (CAS 444004-76-6) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 2,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one. InChIKey: BRERQMIMCLBRCS-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2,4,6,8-tetrahydroxy-1-(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | BRERQMIMCLBRCS-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)OC3=CC(=CC(=C3C2=O)O)O)C |
Computed by PubChem (NCBI)