CAS 444583-22-6 is the registry number for Methyl (R)-2-amino-3-(4-fluorophenyl)propanoate hcl, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate (CAS 444583-22-6) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate. InChIKey: NCSHKOSBEYDZFY-SECBINFHSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate |
| InChIKey | NCSHKOSBEYDZFY-SECBINFHSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)F)N |
Computed by PubChem (NCBI)