CAS 445026-29-9 appears in our catalog under these names: 3-Ethoxy-4-fluorobenzoic acid, 95%, 3-Ethoxy-4-fluorobenzoic acid, 97%, 3-Ethoxy-4-fluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 0,5g, 50mg.
3-ethoxy-4-fluorobenzoic acid (CAS 445026-29-9) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-ethoxy-4-fluorobenzoic acid. InChIKey: PBSYMJHUGMYAIJ-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 3-ethoxy-4-fluorobenzoic acid |
| InChIKey | PBSYMJHUGMYAIJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)