CAS 4453-79-6 is the registry number for 1,3,5-Trimethyl-2-(phenylmethyl)benzene, ≥99%, ≥99%. Offered by: Chemat. Available pack sizes: 1g.
2-benzyl-1,3,5-trimethylbenzene (CAS 4453-79-6) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 2-benzyl-1,3,5-trimethylbenzene. InChIKey: WUOUGWUVWNZBIU-UHFFFAOYSA-N.
| Molecular formula | C16H18 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | 2-benzyl-1,3,5-trimethylbenzene |
| InChIKey | WUOUGWUVWNZBIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)