CAS 445470-08-6 is the registry number for 2-Chloro-4-phenyl-oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 500mg.
2-chloro-4-phenyl-1,3-oxazole (CAS 445470-08-6) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 2-chloro-4-phenyl-1,3-oxazole. InChIKey: WZZRJXYIRGYIKA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 2-chloro-4-phenyl-1,3-oxazole |
| InChIKey | WZZRJXYIRGYIKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=COC(=N2)Cl |
Computed by PubChem (NCBI)