Products 445493-15-2
CAS 445493-15-2 is the registry number for (S)-6-Fluoro-2-methyl-1,2,3,4-tetrahydroquinolin-1-ium chloride, 99%. Offered by: Chemat. Available pack sizes: 100mg.
(2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride (CAS 445493-15-2) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride. InChIKey: UFUBHMKHWBJKMI-FJXQXJEOSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (2S)-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline;hydrochloride |
| InChIKey | UFUBHMKHWBJKMI-FJXQXJEOSA-N |
| SMILES | C[C@H]1CCC2=C(N1)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)