Products 446254-31-5
CAS 446254-31-5 is the registry number for PBDE 60. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
1,2,3-tribromo-4-(4-bromophenoxy)benzene (CAS 446254-31-5) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 485.79 g/mol. IUPAC name: 1,2,3-tribromo-4-(4-bromophenoxy)benzene. InChIKey: ARERIMFZYPFJAV-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O |
|---|---|
| Molecular weight | 485.79 g/mol |
| IUPAC name | 1,2,3-tribromo-4-(4-bromophenoxy)benzene |
| InChIKey | ARERIMFZYPFJAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C(=C(C=C2)Br)Br)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
1,2,3-tribromo-4-(4-bromophenoxy)benzene, Tetrabromobiphenyl ether, Tetrabromodiphenyl oxide, Diphenyl ether, tetrabromo derivative, Benzene, 1,1'-oxybis-, tetrabromo deriv, Benzene, 1,1'-oxybis-, tetrabromo deriv., Benzene, 1,1'oxybis, tetrabromo deriv., 2,3,4,4'-Tetrabromodiphenyl ether, Benzene, 1,2,3-tribromo-4-(4-bromophenoxy)-, Toluene, dibromo derivative