CAS 446255-38-5 is the registry number for 1,2,3,4,5-Pentabromo-6-(2,3,4-tribromophenoxy)benzene. Offered by: Biosynth. Available pack sizes: 100mg.
1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenoxy)benzene (CAS 446255-38-5) is a chemical compound with the molecular formula C12H2Br8O and a molecular weight of 801.4 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenoxy)benzene. InChIKey: GPQLSLKPHQEEOP-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8O |
|---|---|
| Molecular weight | 801.4 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3,4-tribromophenoxy)benzene |
| InChIKey | GPQLSLKPHQEEOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)