Products 446255-50-1
CAS 446255-50-1 is the registry number for PBDE 201. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
1,2,3,5-tetrabromo-4-(2,3,5,6-tetrabromophenoxy)benzene (CAS 446255-50-1) is a chemical compound with the molecular formula C12H2Br8O and a molecular weight of 801.4 g/mol. IUPAC name: 1,2,3,5-tetrabromo-4-(2,3,5,6-tetrabromophenoxy)benzene. InChIKey: HQWFMMKREWXIGN-UHFFFAOYSA-N.
| Molecular formula | C12H2Br8O |
|---|---|
| Molecular weight | 801.4 g/mol |
| IUPAC name | 1,2,3,5-tetrabromo-4-(2,3,5,6-tetrabromophenoxy)benzene |
| InChIKey | HQWFMMKREWXIGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)Br)OC2=C(C(=CC(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)