CAS 448-36-2 appears in our catalog under these names: 2–Methoxy–4–(trifluoromethyl)benzoic acid, 2-Methoxy-4-(trifluoromethyl)benzoic acid, 97%, 2-Methoxy-4-(trifluoromethyl)benzoic acid, 95%, 2-Methoxy-4-(trifluoromethyl)benzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg.
2-methoxy-4-(trifluoromethyl)benzoic acid (CAS 448-36-2) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)benzoic acid. InChIKey: QWRIRBUKLBWVNF-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | QWRIRBUKLBWVNF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)