CAS 4482-27-3 appears in our catalog under these names: 2-Hydroxy-4-phenylbenzoic acid, 97%, 3-Hydroxy-[1,1'-biphenyl]-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-hydroxy-4-phenylbenzoic acid (CAS 4482-27-3) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 2-hydroxy-4-phenylbenzoic acid. InChIKey: IDXMMAOAJXZWSS-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-hydroxy-4-phenylbenzoic acid |
| InChIKey | IDXMMAOAJXZWSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)